ChemNet > CAS > 1131-09-5 Benzo[b]thiophene-3-acetic acid
1131-09-5 Benzo[b]thiophene-3-acetic acid
상품명칭 |
Benzo[b]thiophene-3-acetic acid |
별명 |
Thianaphthene-3-acetic acid; 1-benzothiophen-3-ylacetic acid |
분자식 |
C10H8O2S |
분자량 |
192.2343 |
InChI |
InChI=1/C10H8O2S/c11-10(12)5-7-6-13-9-4-2-1-3-8(7)9/h1-4,6H,5H2,(H,11,12) |
cas번호 |
1131-09-5 |
EC번호 |
214-461-2 |
분자 구조 |
|
밀도 |
1.368g/cm3 |
비등점 |
378.7°C at 760 mmHg |
굴절 지수 |
1.688 |
인화점 |
182.9°C |
위험성 표시 |
|
리스크 규칙 |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|